C23H18N4S2 — CID 4288083
N-[(1-benzylindol-3-yl)methylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-amine (PubChem CID 4288083) has the molecular formula C23H18N4S2 and a molecular weight of 414.56 g/mol. Its IUPAC name is N-[(1-benzylindol-3-yl)methylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-amine.
| Compound Name | N-[(1-benzylindol-3-yl)methylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 4288083 |
| Molecular Formula | C23H18N4S2 |
| Molecular Weight | 414.56 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | N-[(1-benzylindol-3-yl)methylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-amine |
| SMILES | C(=NNc1nc(-c2cccs2)cs1)c1cn(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C23H18N4S2/c1-2-7-17(8-3-1)14-27-15-18(19-9-4-5-10-21(19)27)13-24-26-23-25-20(16-29-23)22-11-6-12-28-22/h1-13,15-16H,14H2,(H,25,26) |
| InChIKey | VGKVBXAGAPANMR-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.56 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_A(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|