C19H15ClN4S — CID 110534611
4-(4-chlorophenyl)-N-[(Z)-(1-methylindol-3-yl)methylideneamino]-1,3-thiazol-2-amine (PubChem CID 110534611) has the molecular formula C19H15ClN4S and a molecular weight of 366.88 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[(Z)-(1-methylindol-3-yl)methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-(4-chlorophenyl)-N-[(Z)-(1-methylindol-3-yl)methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 110534611 |
| Molecular Formula | C19H15ClN4S |
| Molecular Weight | 366.88 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[(Z)-(1-methylindol-3-yl)methylideneamino]-1,3-thiazol-2-amine |
| SMILES | Cn1cc(/C=N\Nc2nc(-c3ccc(Cl)cc3)cs2)c2ccccc21 |
| InChI | InChI=1S/C19H15ClN4S/c1-24-11-14(16-4-2-3-5-18(16)24)10-21-23-19-22-17(12-25-19)13-6-8-15(20)9-7-13/h2-12H,1H3,(H,22,23)/b21-10- |
| InChIKey | NIRJJNSWDBZBJI-FBHDLOMBSA-N |
| XLogP | 5.40 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.88 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_A(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|