C20H14ClN3OS — CID 135607363
1-[(E)-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]naphthalen-2-ol (PubChem CID 135607363) has the molecular formula C20H14ClN3OS and a molecular weight of 379.87 g/mol. Its IUPAC name is 1-[(E)-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]naphthalen-2-ol.
| Compound Name | 1-[(E)-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 135607363 |
| Molecular Formula | C20H14ClN3OS |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | 1-[(E)-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]naphthalen-2-ol |
| SMILES | Oc1ccc2ccccc2c1/C=N/Nc1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C20H14ClN3OS/c21-15-8-5-14(6-9-15)18-12-26-20(23-18)24-22-11-17-16-4-2-1-3-13(16)7-10-19(17)25/h1-12,25H,(H,23,24)/b22-11+ |
| InChIKey | CCTLUASXYPKCBH-SSDVNMTOSA-N |
| XLogP | 5.77 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|