C8H8Br2N2O — CID 136732876
2,6-dibromo-4-[(E)-(methylhydrazinylidene)methyl]phenol (PubChem CID 136732876) has the molecular formula C8H8Br2N2O and a molecular weight of 307.97 g/mol. Its IUPAC name is 2,6-dibromo-4-[(E)-(methylhydrazinylidene)methyl]phenol.
| Compound Name | 2,6-dibromo-4-[(E)-(methylhydrazinylidene)methyl]phenol |
|---|---|
| PubChem CID | 136732876 |
| Molecular Formula | C8H8Br2N2O |
| Molecular Weight | 307.97 g/mol |
| Exact Mass | 305.90 |
| IUPAC Name | 2,6-dibromo-4-[(E)-(methylhydrazinylidene)methyl]phenol |
| SMILES | CN/N=C/c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C8H8Br2N2O/c1-11-12-4-5-2-6(9)8(13)7(10)3-5/h2-4,11,13H,1H3/b12-4+ |
| InChIKey | LTCRAXWRFFHDAB-UUILKARUSA-N |
| XLogP | 2.47 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.97 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|