C8H11Br2N2O5P — CID 136577523
2,4-dibromo-6-[(methylhydrazinylidene)methyl]phenol;phosphoric acid (PubChem CID 136577523) has the molecular formula C8H11Br2N2O5P and a molecular weight of 405.97 g/mol. Its IUPAC name is 2,4-dibromo-6-[(methylhydrazinylidene)methyl]phenol;phosphoric acid.
| Compound Name | 2,4-dibromo-6-[(methylhydrazinylidene)methyl]phenol;phosphoric acid |
|---|---|
| PubChem CID | 136577523 |
| Molecular Formula | C8H11Br2N2O5P |
| Molecular Weight | 405.97 g/mol |
| Exact Mass | 403.88 |
| IUPAC Name | 2,4-dibromo-6-[(methylhydrazinylidene)methyl]phenol;phosphoric acid |
| SMILES | CNN=Cc1cc(Br)cc(Br)c1O.O=P(O)(O)O |
| InChI | InChI=1S/C8H8Br2N2O.H3O4P/c1-11-12-4-5-2-6(9)3-7(10)8(5)13;1-5(2,3)4/h2-4,11,13H,1H3;(H3,1,2,3,4) |
| InChIKey | ILQAIAADPWLKGK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.97 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|