C14H10Br2N2O3 — CID 2789144
4-[2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]hydrazinyl]benzoic acid (PubChem CID 2789144) has the molecular formula C14H10Br2N2O3 and a molecular weight of 414.05 g/mol. Its IUPAC name is 4-[2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]hydrazinyl]benzoic acid.
| Compound Name | 4-[2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 2789144 |
| Molecular Formula | C14H10Br2N2O3 |
| Molecular Weight | 414.05 g/mol |
| Exact Mass | 411.91 |
| IUPAC Name | 4-[2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]hydrazinyl]benzoic acid |
| SMILES | O=C(O)c1ccc(NN=Cc2cc(Br)cc(Br)c2O)cc1 |
| InChI | InChI=1S/C14H10Br2N2O3/c15-10-5-9(13(19)12(16)6-10)7-17-18-11-3-1-8(2-4-11)14(20)21/h1-7,18-19H,(H,20,21) |
| InChIKey | UPXIZEXESVPPEC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.05 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|