C15H12Br2F2N2O — CID 137248796
2,4-dibromo-6-[(E)-[[4-(1,1-difluoroethyl)phenyl]hydrazinylidene]methyl]phenol (PubChem CID 137248796) has the molecular formula C15H12Br2F2N2O and a molecular weight of 434.08 g/mol. Its IUPAC name is 2,4-dibromo-6-[(E)-[[4-(1,1-difluoroethyl)phenyl]hydrazinylidene]methyl]phenol.
| Compound Name | 2,4-dibromo-6-[(E)-[[4-(1,1-difluoroethyl)phenyl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 137248796 |
| Molecular Formula | C15H12Br2F2N2O |
| Molecular Weight | 434.08 g/mol |
| Exact Mass | 431.93 |
| IUPAC Name | 2,4-dibromo-6-[(E)-[[4-(1,1-difluoroethyl)phenyl]hydrazinylidene]methyl]phenol |
| SMILES | CC(F)(F)c1ccc(N/N=C/c2cc(Br)cc(Br)c2O)cc1 |
| InChI | InChI=1S/C15H12Br2F2N2O/c1-15(18,19)10-2-4-12(5-3-10)21-20-8-9-6-11(16)7-13(17)14(9)22/h2-8,21-22H,1H3/b20-8+ |
| InChIKey | WZBZVODOZVOJMH-DNTJNYDQSA-N |
| XLogP | 5.47 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.08 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|