C15H8Br2F4N2O2 — CID 137362061
N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-fluoro-4-(trifluoromethyl)benzamide (PubChem CID 137362061) has the molecular formula C15H8Br2F4N2O2 and a molecular weight of 484.04 g/mol. Its IUPAC name is N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-fluoro-4-(trifluoromethyl)benzamide.
| Compound Name | N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-fluoro-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 137362061 |
| Molecular Formula | C15H8Br2F4N2O2 |
| Molecular Weight | 484.04 g/mol |
| Exact Mass | 481.89 |
| IUPAC Name | N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-fluoro-4-(trifluoromethyl)benzamide |
| SMILES | O=C(N/N=C/c1cc(Br)cc(Br)c1O)c1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C15H8Br2F4N2O2/c16-9-3-7(13(24)11(17)5-9)6-22-23-14(25)10-2-1-8(4-12(10)18)15(19,20)21/h1-6,24H,(H,23,25)/b22-6+ |
| InChIKey | NMFSLVYSXOIMPW-GEVRCRHISA-N |
| XLogP | 4.84 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.04 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|