C17H14BrF3N2O3 — CID 137080251
N-[(Z)-(5-bromo-3-ethoxy-2-hydroxyphenyl)methylideneamino]-3-(trifluoromethyl)benzamide (PubChem CID 137080251) has the molecular formula C17H14BrF3N2O3 and a molecular weight of 431.21 g/mol. Its IUPAC name is N-[(Z)-(5-bromo-3-ethoxy-2-hydroxyphenyl)methylideneamino]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[(Z)-(5-bromo-3-ethoxy-2-hydroxyphenyl)methylideneamino]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 137080251 |
| Molecular Formula | C17H14BrF3N2O3 |
| Molecular Weight | 431.21 g/mol |
| Exact Mass | 430.01 |
| IUPAC Name | N-[(Z)-(5-bromo-3-ethoxy-2-hydroxyphenyl)methylideneamino]-3-(trifluoromethyl)benzamide |
| SMILES | CCOc1cc(Br)cc(/C=N\NC(=O)c2cccc(C(F)(F)F)c2)c1O |
| InChI | InChI=1S/C17H14BrF3N2O3/c1-2-26-14-8-13(18)7-11(15(14)24)9-22-23-16(25)10-4-3-5-12(6-10)17(19,20)21/h3-9,24H,2H2,1H3,(H,23,25)/b22-9- |
| InChIKey | CAPUVHFENBPJKC-AFPJDJCSSA-N |
| XLogP | 4.34 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.21 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|