C15H14Br2N2O — CID 136704721
2,4-dibromo-6-[[(3,4-dimethylphenyl)hydrazinylidene]methyl]phenol (PubChem CID 136704721) has the molecular formula C15H14Br2N2O and a molecular weight of 398.10 g/mol. Its IUPAC name is 2,4-dibromo-6-[[(3,4-dimethylphenyl)hydrazinylidene]methyl]phenol.
| Compound Name | 2,4-dibromo-6-[[(3,4-dimethylphenyl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 136704721 |
| Molecular Formula | C15H14Br2N2O |
| Molecular Weight | 398.10 g/mol |
| Exact Mass | 395.95 |
| IUPAC Name | 2,4-dibromo-6-[[(3,4-dimethylphenyl)hydrazinylidene]methyl]phenol |
| SMILES | Cc1ccc(NN=Cc2cc(Br)cc(Br)c2O)cc1C |
| InChI | InChI=1S/C15H14Br2N2O/c1-9-3-4-13(5-10(9)2)19-18-8-11-6-12(16)7-14(17)15(11)20/h3-8,19-20H,1-2H3 |
| InChIKey | MCWBLDUXCJYKLP-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.10 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|