C9H9Br2NO — CID 139079595
2,4-dibromo-6-(ethyliminomethyl)phenol (PubChem CID 139079595) has the molecular formula C9H9Br2NO and a molecular weight of 306.99 g/mol. Its IUPAC name is 2,4-dibromo-6-(ethyliminomethyl)phenol.
| Compound Name | 2,4-dibromo-6-(ethyliminomethyl)phenol |
|---|---|
| PubChem CID | 139079595 |
| Molecular Formula | C9H9Br2NO |
| Molecular Weight | 306.99 g/mol |
| Exact Mass | 304.91 |
| IUPAC Name | 2,4-dibromo-6-(ethyliminomethyl)phenol |
| SMILES | CC/N=C/c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C9H9Br2NO/c1-2-12-5-6-3-7(10)4-8(11)9(6)13/h3-5,13H,2H2,1H3/b12-5+ |
| InChIKey | FIXKVLHRRVKPDD-LFYBBSHMSA-N |
| XLogP | 3.36 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.99 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|