C14H16Br2N2O2 — CID 177490098
(E)-4-[2-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]ethylamino]pent-3-en-2-one (PubChem CID 177490098) has the molecular formula C14H16Br2N2O2 and a molecular weight of 404.10 g/mol. Its IUPAC name is (E)-4-[2-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]ethylamino]pent-3-en-2-one.
| Compound Name | (E)-4-[2-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]ethylamino]pent-3-en-2-one |
|---|---|
| PubChem CID | 177490098 |
| Molecular Formula | C14H16Br2N2O2 |
| Molecular Weight | 404.10 g/mol |
| Exact Mass | 401.96 |
| IUPAC Name | (E)-4-[2-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]ethylamino]pent-3-en-2-one |
| SMILES | CC(=O)/C=C(\C)NCC/N=C/c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C14H16Br2N2O2/c1-9(5-10(2)19)18-4-3-17-8-11-6-12(15)7-13(16)14(11)20/h5-8,18,20H,3-4H2,1-2H3/b9-5+,17-8+ |
| InChIKey | MBEHDSAUFPYVHF-RWHMABALSA-N |
| XLogP | 3.42 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.10 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|