C12H16BrClN2O — CID 135912099
2-bromo-4-chloro-6-[2-(propylamino)ethyliminomethyl]phenol (PubChem CID 135912099) has the molecular formula C12H16BrClN2O and a molecular weight of 319.63 g/mol. Its IUPAC name is 2-bromo-4-chloro-6-[2-(propylamino)ethyliminomethyl]phenol.
| Compound Name | 2-bromo-4-chloro-6-[2-(propylamino)ethyliminomethyl]phenol |
|---|---|
| PubChem CID | 135912099 |
| Molecular Formula | C12H16BrClN2O |
| Molecular Weight | 319.63 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 2-bromo-4-chloro-6-[2-(propylamino)ethyliminomethyl]phenol |
| SMILES | CCCNCC/N=C/c1cc(Cl)cc(Br)c1O |
| InChI | InChI=1S/C12H16BrClN2O/c1-2-3-15-4-5-16-8-9-6-10(14)7-11(13)12(9)17/h6-8,15,17H,2-5H2,1H3/b16-8+ |
| InChIKey | QWHOPYSCSSGFLT-LZYBPNLTSA-N |
| XLogP | 3.23 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.63 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|