C15H17BrClN5O — CID 135502998
2-bromo-4-chloro-6-[(E)-[[2-(diethylamino)pyrimidin-4-yl]hydrazinylidene]methyl]phenol (PubChem CID 135502998) has the molecular formula C15H17BrClN5O and a molecular weight of 398.69 g/mol. Its IUPAC name is 2-bromo-4-chloro-6-[(E)-[[2-(diethylamino)pyrimidin-4-yl]hydrazinylidene]methyl]phenol.
| Compound Name | 2-bromo-4-chloro-6-[(E)-[[2-(diethylamino)pyrimidin-4-yl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135502998 |
| Molecular Formula | C15H17BrClN5O |
| Molecular Weight | 398.69 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | 2-bromo-4-chloro-6-[(E)-[[2-(diethylamino)pyrimidin-4-yl]hydrazinylidene]methyl]phenol |
| SMILES | CCN(CC)c1nccc(N/N=C/c2cc(Cl)cc(Br)c2O)n1 |
| InChI | InChI=1S/C15H17BrClN5O/c1-3-22(4-2)15-18-6-5-13(20-15)21-19-9-10-7-11(17)8-12(16)14(10)23/h5-9,23H,3-4H2,1-2H3,(H,18,20,21)/b19-9+ |
| InChIKey | KCQBKZOSPQRNAD-DJKKODMXSA-N |
| XLogP | 3.89 |
| TPSA | 73.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.69 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|