C22H20BrClN8O — CID 5203294
2-bromo-4-chloro-6-[[[4-(3,5-dimethylpyrazol-1-yl)-6-(4-methylanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol (PubChem CID 5203294) has the molecular formula C22H20BrClN8O and a molecular weight of 527.81 g/mol. Its IUPAC name is 2-bromo-4-chloro-6-[[[4-(3,5-dimethylpyrazol-1-yl)-6-(4-methylanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol.
| Compound Name | 2-bromo-4-chloro-6-[[[4-(3,5-dimethylpyrazol-1-yl)-6-(4-methylanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 5203294 |
| Molecular Formula | C22H20BrClN8O |
| Molecular Weight | 527.81 g/mol |
| Exact Mass | 526.06 |
| IUPAC Name | 2-bromo-4-chloro-6-[[[4-(3,5-dimethylpyrazol-1-yl)-6-(4-methylanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol |
| SMILES | Cc1ccc(Nc2nc(NN=Cc3cc(Cl)cc(Br)c3O)nc(-n3nc(C)cc3C)n2)cc1 |
| InChI | InChI=1S/C22H20BrClN8O/c1-12-4-6-17(7-5-12)26-20-27-21(29-22(28-20)32-14(3)8-13(2)31-32)30-25-11-15-9-16(24)10-18(23)19(15)33/h4-11,33H,1-3H3,(H2,26,27,28,29,30) |
| InChIKey | OMCMZKAGSHWPPL-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 113.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.81 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|