C29H28N8O — CID 6076538
6-(3,5-dimethylpyrazol-1-yl)-4-N-(4-methylphenyl)-2-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]-1,3,5-triazine-2,4-diamine (PubChem CID 6076538) has the molecular formula C29H28N8O and a molecular weight of 504.60 g/mol. Its IUPAC name is 6-(3,5-dimethylpyrazol-1-yl)-4-N-(4-methylphenyl)-2-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(3,5-dimethylpyrazol-1-yl)-4-N-(4-methylphenyl)-2-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 6076538 |
| Molecular Formula | C29H28N8O |
| Molecular Weight | 504.60 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | 6-(3,5-dimethylpyrazol-1-yl)-4-N-(4-methylphenyl)-2-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc(Nc2nc(N/N=C\c3ccccc3OCc3ccccc3)nc(-n3nc(C)cc3C)n2)cc1 |
| InChI | InChI=1S/C29H28N8O/c1-20-13-15-25(16-14-20)31-27-32-28(34-29(33-27)37-22(3)17-21(2)36-37)35-30-18-24-11-7-8-12-26(24)38-19-23-9-5-4-6-10-23/h4-18H,19H2,1-3H3,(H2,31,32,33,34,35)/b30-18- |
| InChIKey | SXFIYRRVHIYFMJ-YKQZZPSBSA-N |
| XLogP | 5.75 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.60 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|