C21H19BrN8O — CID 3280027
2-[[[4-anilino-6-(3,5-dimethylpyrazol-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-bromophenol (PubChem CID 3280027) has the molecular formula C21H19BrN8O and a molecular weight of 479.34 g/mol. Its IUPAC name is 2-[[[4-anilino-6-(3,5-dimethylpyrazol-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-bromophenol.
| Compound Name | 2-[[[4-anilino-6-(3,5-dimethylpyrazol-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-bromophenol |
|---|---|
| PubChem CID | 3280027 |
| Molecular Formula | C21H19BrN8O |
| Molecular Weight | 479.34 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 2-[[[4-anilino-6-(3,5-dimethylpyrazol-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-bromophenol |
| SMILES | Cc1cc(C)n(-c2nc(NN=Cc3cc(Br)ccc3O)nc(Nc3ccccc3)n2)n1 |
| InChI | InChI=1S/C21H19BrN8O/c1-13-10-14(2)30(29-13)21-26-19(24-17-6-4-3-5-7-17)25-20(27-21)28-23-12-15-11-16(22)8-9-18(15)31/h3-12,31H,1-2H3,(H2,24,25,26,27,28) |
| InChIKey | LGDBERAGTCUTJY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 113.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|