C21H18BrN9O3 — CID 3333661
2-[[[4-anilino-6-(3,5-dimethylpyrazol-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-bromo-6-nitrophenol (PubChem CID 3333661) has the molecular formula C21H18BrN9O3 and a molecular weight of 524.34 g/mol. Its IUPAC name is 2-[[[4-anilino-6-(3,5-dimethylpyrazol-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-bromo-6-nitrophenol.
| Compound Name | 2-[[[4-anilino-6-(3,5-dimethylpyrazol-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-bromo-6-nitrophenol |
|---|---|
| PubChem CID | 3333661 |
| Molecular Formula | C21H18BrN9O3 |
| Molecular Weight | 524.34 g/mol |
| Exact Mass | 523.07 |
| IUPAC Name | 2-[[[4-anilino-6-(3,5-dimethylpyrazol-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-bromo-6-nitrophenol |
| SMILES | Cc1cc(C)n(-c2nc(NN=Cc3cc(Br)cc([N+](=O)[O-])c3O)nc(Nc3ccccc3)n2)n1 |
| InChI | InChI=1S/C21H18BrN9O3/c1-12-8-13(2)30(29-12)21-26-19(24-16-6-4-3-5-7-16)25-20(27-21)28-23-11-14-9-15(22)10-17(18(14)32)31(33)34/h3-11,32H,1-2H3,(H2,24,25,26,27,28) |
| InChIKey | CZCVGKBZRBSLAL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 156.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.34 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|