C14H11BrClF2N3O — CID 143199924
2-bromo-4-chloro-6-[(E)-[[4-(difluoromethyl)-6-methyl-2-pyridinyl]hydrazinylidene]methyl]phenol (PubChem CID 143199924) has the molecular formula C14H11BrClF2N3O and a molecular weight of 390.62 g/mol. Its IUPAC name is 2-bromo-4-chloro-6-[(E)-[[4-(difluoromethyl)-6-methyl-2-pyridinyl]hydrazinylidene]methyl]phenol.
| Compound Name | 2-bromo-4-chloro-6-[(E)-[[4-(difluoromethyl)-6-methyl-2-pyridinyl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 143199924 |
| Molecular Formula | C14H11BrClF2N3O |
| Molecular Weight | 390.62 g/mol |
| Exact Mass | 388.97 |
| IUPAC Name | 2-bromo-4-chloro-6-[(E)-[[4-(difluoromethyl)-6-methyl-2-pyridinyl]hydrazinylidene]methyl]phenol |
| SMILES | Cc1cc(C(F)F)cc(N/N=C/c2cc(Cl)cc(Br)c2O)n1 |
| InChI | InChI=1S/C14H11BrClF2N3O/c1-7-2-8(14(17)18)4-12(20-7)21-19-6-9-3-10(16)5-11(15)13(9)22/h2-6,14,22H,1H3,(H,20,21)/b19-6+ |
| InChIKey | CUNUGHGFVIOUHM-KPSZGOFPSA-N |
| XLogP | 4.90 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.62 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|