C19H16Br2N4O2 — CID 3099378
2,4-dibromo-6-[4-[2-[(2-methoxyphenyl)methylidene]hydrazinyl]-6-methylpyrimidin-2-yl]phenol (PubChem CID 3099378) has the molecular formula C19H16Br2N4O2 and a molecular weight of 492.17 g/mol. Its IUPAC name is 2,4-dibromo-6-[4-[2-[(2-methoxyphenyl)methylidene]hydrazinyl]-6-methylpyrimidin-2-yl]phenol.
| Compound Name | 2,4-dibromo-6-[4-[2-[(2-methoxyphenyl)methylidene]hydrazinyl]-6-methylpyrimidin-2-yl]phenol |
|---|---|
| PubChem CID | 3099378 |
| Molecular Formula | C19H16Br2N4O2 |
| Molecular Weight | 492.17 g/mol |
| Exact Mass | 489.96 |
| IUPAC Name | 2,4-dibromo-6-[4-[2-[(2-methoxyphenyl)methylidene]hydrazinyl]-6-methylpyrimidin-2-yl]phenol |
| SMILES | COc1ccccc1C=NNc1cc(C)nc(-c2cc(Br)cc(Br)c2O)n1 |
| InChI | InChI=1S/C19H16Br2N4O2/c1-11-7-17(25-22-10-12-5-3-4-6-16(12)27-2)24-19(23-11)14-8-13(20)9-15(21)18(14)26/h3-10,26H,1-2H3,(H,23,24,25) |
| InChIKey | AISZGWKSMPGMBO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.17 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|