C20H18Br2N4O3 — CID 135536505
2,4-dibromo-6-[4-[(2E)-2-[(4-ethoxy-2-hydroxyphenyl)methylidene]hydrazinyl]-6-methylpyrimidin-2-yl]phenol (PubChem CID 135536505) has the molecular formula C20H18Br2N4O3 and a molecular weight of 522.20 g/mol. Its IUPAC name is 2,4-dibromo-6-[4-[(2E)-2-[(4-ethoxy-2-hydroxyphenyl)methylidene]hydrazinyl]-6-methylpyrimidin-2-yl]phenol.
| Compound Name | 2,4-dibromo-6-[4-[(2E)-2-[(4-ethoxy-2-hydroxyphenyl)methylidene]hydrazinyl]-6-methylpyrimidin-2-yl]phenol |
|---|---|
| PubChem CID | 135536505 |
| Molecular Formula | C20H18Br2N4O3 |
| Molecular Weight | 522.20 g/mol |
| Exact Mass | 519.97 |
| IUPAC Name | 2,4-dibromo-6-[4-[(2E)-2-[(4-ethoxy-2-hydroxyphenyl)methylidene]hydrazinyl]-6-methylpyrimidin-2-yl]phenol |
| SMILES | CCOc1ccc(/C=N/Nc2cc(C)nc(-c3cc(Br)cc(Br)c3O)n2)c(O)c1 |
| InChI | InChI=1S/C20H18Br2N4O3/c1-3-29-14-5-4-12(17(27)9-14)10-23-26-18-6-11(2)24-20(25-18)15-7-13(21)8-16(22)19(15)28/h4-10,27-28H,3H2,1-2H3,(H,24,25,26)/b23-10+ |
| InChIKey | UNVHUQKDTYPTPX-AUEPDCJTSA-N |
| XLogP | 5.23 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.20 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|