C21H20Br2N4O3 — CID 135536503
2,4-dibromo-6-[4-[(2E)-2-[(2-hydroxy-4-propoxyphenyl)methylidene]hydrazinyl]-6-methylpyrimidin-2-yl]phenol (PubChem CID 135536503) has the molecular formula C21H20Br2N4O3 and a molecular weight of 536.22 g/mol. Its IUPAC name is 2,4-dibromo-6-[4-[(2E)-2-[(2-hydroxy-4-propoxyphenyl)methylidene]hydrazinyl]-6-methylpyrimidin-2-yl]phenol.
| Compound Name | 2,4-dibromo-6-[4-[(2E)-2-[(2-hydroxy-4-propoxyphenyl)methylidene]hydrazinyl]-6-methylpyrimidin-2-yl]phenol |
|---|---|
| PubChem CID | 135536503 |
| Molecular Formula | C21H20Br2N4O3 |
| Molecular Weight | 536.22 g/mol |
| Exact Mass | 533.99 |
| IUPAC Name | 2,4-dibromo-6-[4-[(2E)-2-[(2-hydroxy-4-propoxyphenyl)methylidene]hydrazinyl]-6-methylpyrimidin-2-yl]phenol |
| SMILES | CCCOc1ccc(/C=N/Nc2cc(C)nc(-c3cc(Br)cc(Br)c3O)n2)c(O)c1 |
| InChI | InChI=1S/C21H20Br2N4O3/c1-3-6-30-15-5-4-13(18(28)10-15)11-24-27-19-7-12(2)25-21(26-19)16-8-14(22)9-17(23)20(16)29/h4-5,7-11,28-29H,3,6H2,1-2H3,(H,25,26,27)/b24-11+ |
| InChIKey | IVWNQLQQESAXAU-BHGWPJFGSA-N |
| XLogP | 5.62 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.22 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|