C19H15Br3N4O — CID 3099399
2,4-dibromo-6-[4-[2-[1-(4-bromophenyl)ethylidene]hydrazinyl]-6-methylpyrimidin-2-yl]phenol (PubChem CID 3099399) has the molecular formula C19H15Br3N4O and a molecular weight of 555.07 g/mol. Its IUPAC name is 2,4-dibromo-6-[4-[2-[1-(4-bromophenyl)ethylidene]hydrazinyl]-6-methylpyrimidin-2-yl]phenol.
| Compound Name | 2,4-dibromo-6-[4-[2-[1-(4-bromophenyl)ethylidene]hydrazinyl]-6-methylpyrimidin-2-yl]phenol |
|---|---|
| PubChem CID | 3099399 |
| Molecular Formula | C19H15Br3N4O |
| Molecular Weight | 555.07 g/mol |
| Exact Mass | 551.88 |
| IUPAC Name | 2,4-dibromo-6-[4-[2-[1-(4-bromophenyl)ethylidene]hydrazinyl]-6-methylpyrimidin-2-yl]phenol |
| SMILES | CC(=NNc1cc(C)nc(-c2cc(Br)cc(Br)c2O)n1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H15Br3N4O/c1-10-7-17(26-25-11(2)12-3-5-13(20)6-4-12)24-19(23-10)15-8-14(21)9-16(22)18(15)27/h3-9,27H,1-2H3,(H,23,24,26) |
| InChIKey | OIKVNKZYXZTSAE-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.07 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|