C18H13Br2N5O3 — CID 136870503
2,4-dibromo-6-[4-methyl-6-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]pyrimidin-2-yl]phenol (PubChem CID 136870503) has the molecular formula C18H13Br2N5O3 and a molecular weight of 507.14 g/mol. Its IUPAC name is 2,4-dibromo-6-[4-methyl-6-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]pyrimidin-2-yl]phenol.
| Compound Name | 2,4-dibromo-6-[4-methyl-6-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]pyrimidin-2-yl]phenol |
|---|---|
| PubChem CID | 136870503 |
| Molecular Formula | C18H13Br2N5O3 |
| Molecular Weight | 507.14 g/mol |
| Exact Mass | 504.94 |
| IUPAC Name | 2,4-dibromo-6-[4-methyl-6-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]pyrimidin-2-yl]phenol |
| SMILES | Cc1cc(N/N=C\c2cccc([N+](=O)[O-])c2)nc(-c2cc(Br)cc(Br)c2O)n1 |
| InChI | InChI=1S/C18H13Br2N5O3/c1-10-5-16(24-21-9-11-3-2-4-13(6-11)25(27)28)23-18(22-10)14-7-12(19)8-15(20)17(14)26/h2-9,26H,1H3,(H,22,23,24)/b21-9- |
| InChIKey | CGHIQFCIYADPMI-NKVSQWTQSA-N |
| XLogP | 5.04 |
| TPSA | 113.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.14 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|