C13H9Br2N3O3 — CID 21204190
2,6-dibromo-4-[(2E)-2-[(3-nitrophenyl)methylidene]hydrazinyl]phenol (PubChem CID 21204190) has the molecular formula C13H9Br2N3O3 and a molecular weight of 415.04 g/mol. Its IUPAC name is 2,6-dibromo-4-[(2E)-2-[(3-nitrophenyl)methylidene]hydrazinyl]phenol.
| Compound Name | 2,6-dibromo-4-[(2E)-2-[(3-nitrophenyl)methylidene]hydrazinyl]phenol |
|---|---|
| PubChem CID | 21204190 |
| Molecular Formula | C13H9Br2N3O3 |
| Molecular Weight | 415.04 g/mol |
| Exact Mass | 412.90 |
| IUPAC Name | 2,6-dibromo-4-[(2E)-2-[(3-nitrophenyl)methylidene]hydrazinyl]phenol |
| SMILES | O=[N+]([O-])c1cccc(/C=N/Nc2cc(Br)c(O)c(Br)c2)c1 |
| InChI | InChI=1S/C13H9Br2N3O3/c14-11-5-9(6-12(15)13(11)19)17-16-7-8-2-1-3-10(4-8)18(20)21/h1-7,17,19H/b16-7+ |
| InChIKey | UQHNQTVZWAFSKZ-FRKPEAEDSA-N |
| XLogP | 4.27 |
| TPSA | 87.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.04 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|