C21H21BrN4O2 — CID 135495747
2-[(E)-[[2-(4-bromophenyl)-6-methylpyrimidin-4-yl]hydrazinylidene]methyl]-5-propoxyphenol (PubChem CID 135495747) has the molecular formula C21H21BrN4O2 and a molecular weight of 441.33 g/mol. Its IUPAC name is 2-[(E)-[[2-(4-bromophenyl)-6-methylpyrimidin-4-yl]hydrazinylidene]methyl]-5-propoxyphenol.
| Compound Name | 2-[(E)-[[2-(4-bromophenyl)-6-methylpyrimidin-4-yl]hydrazinylidene]methyl]-5-propoxyphenol |
|---|---|
| PubChem CID | 135495747 |
| Molecular Formula | C21H21BrN4O2 |
| Molecular Weight | 441.33 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 2-[(E)-[[2-(4-bromophenyl)-6-methylpyrimidin-4-yl]hydrazinylidene]methyl]-5-propoxyphenol |
| SMILES | CCCOc1ccc(/C=N/Nc2cc(C)nc(-c3ccc(Br)cc3)n2)c(O)c1 |
| InChI | InChI=1S/C21H21BrN4O2/c1-3-10-28-18-9-6-16(19(27)12-18)13-23-26-20-11-14(2)24-21(25-20)15-4-7-17(22)8-5-15/h4-9,11-13,27H,3,10H2,1-2H3,(H,24,25,26)/b23-13+ |
| InChIKey | HZCRIIWZMQNDPD-YDZHTSKRSA-N |
| XLogP | 5.15 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.33 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|