C23H17BrN4O — CID 135907237
2-[(Z)-[[2-(4-bromophenyl)-6-phenylpyrimidin-4-yl]hydrazinylidene]methyl]phenol (PubChem CID 135907237) has the molecular formula C23H17BrN4O and a molecular weight of 445.32 g/mol. Its IUPAC name is 2-[(Z)-[[2-(4-bromophenyl)-6-phenylpyrimidin-4-yl]hydrazinylidene]methyl]phenol.
| Compound Name | 2-[(Z)-[[2-(4-bromophenyl)-6-phenylpyrimidin-4-yl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135907237 |
| Molecular Formula | C23H17BrN4O |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 2-[(Z)-[[2-(4-bromophenyl)-6-phenylpyrimidin-4-yl]hydrazinylidene]methyl]phenol |
| SMILES | Oc1ccccc1/C=N\Nc1cc(-c2ccccc2)nc(-c2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C23H17BrN4O/c24-19-12-10-17(11-13-19)23-26-20(16-6-2-1-3-7-16)14-22(27-23)28-25-15-18-8-4-5-9-21(18)29/h1-15,29H,(H,26,27,28)/b25-15- |
| InChIKey | ZCAMFPAAPBLIEH-MYYYXRDXSA-N |
| XLogP | 5.72 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|