C23H15BrCl2N4O — CID 135421739
2-[(E)-[[4-(4-bromophenyl)-6-phenylpyrimidin-2-yl]hydrazinylidene]methyl]-4,6-dichlorophenol (PubChem CID 135421739) has the molecular formula C23H15BrCl2N4O and a molecular weight of 514.21 g/mol. Its IUPAC name is 2-[(E)-[[4-(4-bromophenyl)-6-phenylpyrimidin-2-yl]hydrazinylidene]methyl]-4,6-dichlorophenol.
| Compound Name | 2-[(E)-[[4-(4-bromophenyl)-6-phenylpyrimidin-2-yl]hydrazinylidene]methyl]-4,6-dichlorophenol |
|---|---|
| PubChem CID | 135421739 |
| Molecular Formula | C23H15BrCl2N4O |
| Molecular Weight | 514.21 g/mol |
| Exact Mass | 511.98 |
| IUPAC Name | 2-[(E)-[[4-(4-bromophenyl)-6-phenylpyrimidin-2-yl]hydrazinylidene]methyl]-4,6-dichlorophenol |
| SMILES | Oc1c(Cl)cc(Cl)cc1/C=N/Nc1nc(-c2ccccc2)cc(-c2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C23H15BrCl2N4O/c24-17-8-6-15(7-9-17)21-12-20(14-4-2-1-3-5-14)28-23(29-21)30-27-13-16-10-18(25)11-19(26)22(16)31/h1-13,31H,(H,28,29,30)/b27-13+ |
| InChIKey | ZPVVAGVTYLSJGL-UVHMKAGCSA-N |
| XLogP | 7.03 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.21 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|