C17H11Cl2N5O3 — CID 135588478
2,4-dichloro-6-[(E)-[[5-(4-nitrophenyl)pyrimidin-2-yl]hydrazinylidene]methyl]phenol (PubChem CID 135588478) has the molecular formula C17H11Cl2N5O3 and a molecular weight of 404.21 g/mol. Its IUPAC name is 2,4-dichloro-6-[(E)-[[5-(4-nitrophenyl)pyrimidin-2-yl]hydrazinylidene]methyl]phenol.
| Compound Name | 2,4-dichloro-6-[(E)-[[5-(4-nitrophenyl)pyrimidin-2-yl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135588478 |
| Molecular Formula | C17H11Cl2N5O3 |
| Molecular Weight | 404.21 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | 2,4-dichloro-6-[(E)-[[5-(4-nitrophenyl)pyrimidin-2-yl]hydrazinylidene]methyl]phenol |
| SMILES | O=[N+]([O-])c1ccc(-c2cnc(N/N=C/c3cc(Cl)cc(Cl)c3O)nc2)cc1 |
| InChI | InChI=1S/C17H11Cl2N5O3/c18-13-5-11(16(25)15(19)6-13)9-22-23-17-20-7-12(8-21-17)10-1-3-14(4-2-10)24(26)27/h1-9,25H,(H,20,21,23)/b22-9+ |
| InChIKey | PKNHLRONKCNNQA-LSFURLLWSA-N |
| XLogP | 4.51 |
| TPSA | 113.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.21 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|