C13H10Cl2N4O3 — CID 136897084
2,4-dichloro-6-[(Z)-[methyl-(5-nitro-2-pyridinyl)hydrazinylidene]methyl]phenol (PubChem CID 136897084) has the molecular formula C13H10Cl2N4O3 and a molecular weight of 341.15 g/mol. Its IUPAC name is 2,4-dichloro-6-[(Z)-[methyl-(5-nitro-2-pyridinyl)hydrazinylidene]methyl]phenol.
| Compound Name | 2,4-dichloro-6-[(Z)-[methyl-(5-nitro-2-pyridinyl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 136897084 |
| Molecular Formula | C13H10Cl2N4O3 |
| Molecular Weight | 341.15 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 2,4-dichloro-6-[(Z)-[methyl-(5-nitro-2-pyridinyl)hydrazinylidene]methyl]phenol |
| SMILES | CN(/N=C\c1cc(Cl)cc(Cl)c1O)c1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C13H10Cl2N4O3/c1-18(12-3-2-10(7-16-12)19(21)22)17-6-8-4-9(14)5-11(15)13(8)20/h2-7,20H,1H3/b17-6- |
| InChIKey | OKZNNWFGJDXWMM-FMQZQXMHSA-N |
| XLogP | 3.47 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.15 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|