C15H10Cl2F3N3O3 — CID 135520632
2,4-dichloro-6-[(E)-[methyl-[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenol (PubChem CID 135520632) has the molecular formula C15H10Cl2F3N3O3 and a molecular weight of 408.16 g/mol. Its IUPAC name is 2,4-dichloro-6-[(E)-[methyl-[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenol.
| Compound Name | 2,4-dichloro-6-[(E)-[methyl-[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135520632 |
| Molecular Formula | C15H10Cl2F3N3O3 |
| Molecular Weight | 408.16 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | 2,4-dichloro-6-[(E)-[methyl-[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenol |
| SMILES | CN(/N=C/c1cc(Cl)cc(Cl)c1O)c1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H10Cl2F3N3O3/c1-22(21-7-8-4-10(16)6-11(17)14(8)24)12-3-2-9(15(18,19)20)5-13(12)23(25)26/h2-7,24H,1H3/b21-7+ |
| InChIKey | QDNVISPPELMUHY-QPSGOUHRSA-N |
| XLogP | 5.10 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.16 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|