C15H7Cl2N5O3 — CID 136678563
4-[(2Z)-2-[(3,5-dichloro-2-hydroxyphenyl)methylidene]hydrazinyl]-5-nitrobenzene-1,2-dicarbonitrile (PubChem CID 136678563) has the molecular formula C15H7Cl2N5O3 and a molecular weight of 376.16 g/mol. Its IUPAC name is 4-[(2Z)-2-[(3,5-dichloro-2-hydroxyphenyl)methylidene]hydrazinyl]-5-nitrobenzene-1,2-dicarbonitrile.
| Compound Name | 4-[(2Z)-2-[(3,5-dichloro-2-hydroxyphenyl)methylidene]hydrazinyl]-5-nitrobenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 136678563 |
| Molecular Formula | C15H7Cl2N5O3 |
| Molecular Weight | 376.16 g/mol |
| Exact Mass | 374.99 |
| IUPAC Name | 4-[(2Z)-2-[(3,5-dichloro-2-hydroxyphenyl)methylidene]hydrazinyl]-5-nitrobenzene-1,2-dicarbonitrile |
| SMILES | N#Cc1cc(N/N=C\c2cc(Cl)cc(Cl)c2O)c([N+](=O)[O-])cc1C#N |
| InChI | InChI=1S/C15H7Cl2N5O3/c16-11-1-10(15(23)12(17)4-11)7-20-21-13-2-8(5-18)9(6-19)3-14(13)22(24)25/h1-4,7,21,23H/b20-7- |
| InChIKey | ZCJNUWWONCJDCL-SCDVKCJHSA-N |
| XLogP | 3.80 |
| TPSA | 135.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.16 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|