C19H11N5O3 — CID 135567716
4-[(2E)-2-[(2-hydroxynaphthalen-1-yl)methylidene]hydrazinyl]-5-nitrobenzene-1,2-dicarbonitrile (PubChem CID 135567716) has the molecular formula C19H11N5O3 and a molecular weight of 357.33 g/mol. Its IUPAC name is 4-[(2E)-2-[(2-hydroxynaphthalen-1-yl)methylidene]hydrazinyl]-5-nitrobenzene-1,2-dicarbonitrile.
| Compound Name | 4-[(2E)-2-[(2-hydroxynaphthalen-1-yl)methylidene]hydrazinyl]-5-nitrobenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 135567716 |
| Molecular Formula | C19H11N5O3 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 4-[(2E)-2-[(2-hydroxynaphthalen-1-yl)methylidene]hydrazinyl]-5-nitrobenzene-1,2-dicarbonitrile |
| SMILES | N#Cc1cc(N/N=C/c2c(O)ccc3ccccc23)c([N+](=O)[O-])cc1C#N |
| InChI | InChI=1S/C19H11N5O3/c20-9-13-7-17(18(24(26)27)8-14(13)10-21)23-22-11-16-15-4-2-1-3-12(15)5-6-19(16)25/h1-8,11,23,25H/b22-11+ |
| InChIKey | MDYPMCKRZMSPNW-SSDVNMTOSA-N |
| XLogP | 3.64 |
| TPSA | 135.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|