C16H12N4OS2 — CID 135508996
5-[(2E)-2-[(2-hydroxynaphthalen-1-yl)methylidene]hydrazinyl]-3-methylsulfanyl-1,2-thiazole-4-carbonitrile (PubChem CID 135508996) has the molecular formula C16H12N4OS2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 5-[(2E)-2-[(2-hydroxynaphthalen-1-yl)methylidene]hydrazinyl]-3-methylsulfanyl-1,2-thiazole-4-carbonitrile.
| Compound Name | 5-[(2E)-2-[(2-hydroxynaphthalen-1-yl)methylidene]hydrazinyl]-3-methylsulfanyl-1,2-thiazole-4-carbonitrile |
|---|---|
| PubChem CID | 135508996 |
| Molecular Formula | C16H12N4OS2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 5-[(2E)-2-[(2-hydroxynaphthalen-1-yl)methylidene]hydrazinyl]-3-methylsulfanyl-1,2-thiazole-4-carbonitrile |
| SMILES | CSc1nsc(N/N=C/c2c(O)ccc3ccccc23)c1C#N |
| InChI | InChI=1S/C16H12N4OS2/c1-22-16-12(8-17)15(23-20-16)19-18-9-13-11-5-3-2-4-10(11)6-7-14(13)21/h2-7,9,19,21H,1H3/b18-9+ |
| InChIKey | XWBDZCNUZBRQLI-GIJQJNRQSA-N |
| XLogP | 4.04 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|