C15H15N3O — CID 2322941
1-[(3,4-dihydro-2H-pyrrol-5-ylhydrazinylidene)methyl]naphthalen-2-ol (PubChem CID 2322941) has the molecular formula C15H15N3O and a molecular weight of 253.31 g/mol. Its IUPAC name is 1-[(3,4-dihydro-2H-pyrrol-5-ylhydrazinylidene)methyl]naphthalen-2-ol.
| Compound Name | 1-[(3,4-dihydro-2H-pyrrol-5-ylhydrazinylidene)methyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 2322941 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 1-[(3,4-dihydro-2H-pyrrol-5-ylhydrazinylidene)methyl]naphthalen-2-ol |
| SMILES | Oc1ccc2ccccc2c1C=NNC1=NCCC1 |
| InChI | InChI=1S/C15H15N3O/c19-14-8-7-11-4-1-2-5-12(11)13(14)10-17-18-15-6-3-9-16-15/h1-2,4-5,7-8,10,19H,3,6,9H2,(H,16,18) |
| InChIKey | VWMDJYBHYMNBJE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 56.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|