C26H19N5O — CID 2848301
1-[[(5,6-diphenyl-1,2,4-triazin-3-yl)hydrazinylidene]methyl]naphthalen-2-ol (PubChem CID 2848301) has the molecular formula C26H19N5O and a molecular weight of 417.47 g/mol. Its IUPAC name is 1-[[(5,6-diphenyl-1,2,4-triazin-3-yl)hydrazinylidene]methyl]naphthalen-2-ol.
| Compound Name | 1-[[(5,6-diphenyl-1,2,4-triazin-3-yl)hydrazinylidene]methyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 2848301 |
| Molecular Formula | C26H19N5O |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 1-[[(5,6-diphenyl-1,2,4-triazin-3-yl)hydrazinylidene]methyl]naphthalen-2-ol |
| SMILES | Oc1ccc2ccccc2c1C=NNc1nnc(-c2ccccc2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C26H19N5O/c32-23-16-15-18-9-7-8-14-21(18)22(23)17-27-30-26-28-24(19-10-3-1-4-11-19)25(29-31-26)20-12-5-2-6-13-20/h1-17,32H,(H,28,30,31) |
| InChIKey | CZMLQYVWFRVUQW-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 83.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|