C25H19Cl4N7O3 — CID 139976647
2,4-dichloro-6-[[[2-[2-[(3,5-dichloro-2-hydroxyphenyl)methylidene]hydrazinyl]-6-(2-methoxyanilino)pyrimidin-4-yl]hydrazinylidene]methyl]phenol (PubChem CID 139976647) has the molecular formula C25H19Cl4N7O3 and a molecular weight of 607.29 g/mol. Its IUPAC name is 2,4-dichloro-6-[[[2-[2-[(3,5-dichloro-2-hydroxyphenyl)methylidene]hydrazinyl]-6-(2-methoxyanilino)pyrimidin-4-yl]hydrazinylidene]methyl]phenol.
| Compound Name | 2,4-dichloro-6-[[[2-[2-[(3,5-dichloro-2-hydroxyphenyl)methylidene]hydrazinyl]-6-(2-methoxyanilino)pyrimidin-4-yl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 139976647 |
| Molecular Formula | C25H19Cl4N7O3 |
| Molecular Weight | 607.29 g/mol |
| Exact Mass | 605.03 |
| IUPAC Name | 2,4-dichloro-6-[[[2-[2-[(3,5-dichloro-2-hydroxyphenyl)methylidene]hydrazinyl]-6-(2-methoxyanilino)pyrimidin-4-yl]hydrazinylidene]methyl]phenol |
| SMILES | COc1ccccc1Nc1cc(NN=Cc2cc(Cl)cc(Cl)c2O)nc(NN=Cc2cc(Cl)cc(Cl)c2O)n1 |
| InChI | InChI=1S/C25H19Cl4N7O3/c1-39-20-5-3-2-4-19(20)32-21-10-22(35-30-11-13-6-15(26)8-17(28)23(13)37)34-25(33-21)36-31-12-14-7-16(27)9-18(29)24(14)38/h2-12,37-38H,1H3,(H3,32,33,34,35,36) |
| InChIKey | PDTYEZMXVRSUAK-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 136.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.29 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|