C27H19F8N7O — CID 139976010
2-N,4-N-bis[[4-fluoro-2-(trifluoromethyl)phenyl]methylideneamino]-6-N-(2-methoxyphenyl)pyrimidine-2,4,6-triamine (PubChem CID 139976010) has the molecular formula C27H19F8N7O and a molecular weight of 609.48 g/mol. Its IUPAC name is 2-N,4-N-bis[[4-fluoro-2-(trifluoromethyl)phenyl]methylideneamino]-6-N-(2-methoxyphenyl)pyrimidine-2,4,6-triamine.
| Compound Name | 2-N,4-N-bis[[4-fluoro-2-(trifluoromethyl)phenyl]methylideneamino]-6-N-(2-methoxyphenyl)pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 139976010 |
| Molecular Formula | C27H19F8N7O |
| Molecular Weight | 609.48 g/mol |
| Exact Mass | 609.15 |
| IUPAC Name | 2-N,4-N-bis[[4-fluoro-2-(trifluoromethyl)phenyl]methylideneamino]-6-N-(2-methoxyphenyl)pyrimidine-2,4,6-triamine |
| SMILES | COc1ccccc1Nc1cc(NN=Cc2ccc(F)cc2C(F)(F)F)nc(NN=Cc2ccc(F)cc2C(F)(F)F)n1 |
| InChI | InChI=1S/C27H19F8N7O/c1-43-22-5-3-2-4-21(22)38-23-12-24(41-36-13-15-6-8-17(28)10-19(15)26(30,31)32)40-25(39-23)42-37-14-16-7-9-18(29)11-20(16)27(33,34)35/h2-14H,1H3,(H3,38,39,40,41,42) |
| InChIKey | MSXVOWFFBSJHOM-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 95.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.48 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|