C21H23N11O — CID 139976179
6-N-(2-methoxyphenyl)-2-N,4-N-bis[(1-methylimidazol-2-yl)methylideneamino]pyrimidine-2,4,6-triamine (PubChem CID 139976179) has the molecular formula C21H23N11O and a molecular weight of 445.49 g/mol. Its IUPAC name is 6-N-(2-methoxyphenyl)-2-N,4-N-bis[(1-methylimidazol-2-yl)methylideneamino]pyrimidine-2,4,6-triamine.
| Compound Name | 6-N-(2-methoxyphenyl)-2-N,4-N-bis[(1-methylimidazol-2-yl)methylideneamino]pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 139976179 |
| Molecular Formula | C21H23N11O |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 6-N-(2-methoxyphenyl)-2-N,4-N-bis[(1-methylimidazol-2-yl)methylideneamino]pyrimidine-2,4,6-triamine |
| SMILES | COc1ccccc1Nc1cc(NN=Cc2nccn2C)nc(NN=Cc2nccn2C)n1 |
| InChI | InChI=1S/C21H23N11O/c1-31-10-8-22-19(31)13-24-29-18-12-17(26-15-6-4-5-7-16(15)33-3)27-21(28-18)30-25-14-20-23-9-11-32(20)2/h4-14H,1-3H3,(H3,26,27,28,29,30) |
| InChIKey | HFPAVNZVRGXUIX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 131.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|