C25H21N9O5 — CID 139976518
6-N-(2-methoxyphenyl)-2-N,4-N-bis[(3-nitrophenyl)methylideneamino]pyrimidine-2,4,6-triamine (PubChem CID 139976518) has the molecular formula C25H21N9O5 and a molecular weight of 527.50 g/mol. Its IUPAC name is 6-N-(2-methoxyphenyl)-2-N,4-N-bis[(3-nitrophenyl)methylideneamino]pyrimidine-2,4,6-triamine.
| Compound Name | 6-N-(2-methoxyphenyl)-2-N,4-N-bis[(3-nitrophenyl)methylideneamino]pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 139976518 |
| Molecular Formula | C25H21N9O5 |
| Molecular Weight | 527.50 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | 6-N-(2-methoxyphenyl)-2-N,4-N-bis[(3-nitrophenyl)methylideneamino]pyrimidine-2,4,6-triamine |
| SMILES | COc1ccccc1Nc1cc(NN=Cc2cccc([N+](=O)[O-])c2)nc(NN=Cc2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C25H21N9O5/c1-39-22-11-3-2-10-21(22)28-23-14-24(31-26-15-17-6-4-8-19(12-17)33(35)36)30-25(29-23)32-27-16-18-7-5-9-20(13-18)34(37)38/h2-16H,1H3,(H3,28,29,30,31,32) |
| InChIKey | RURKOWZMYHASMM-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 182.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|