C19H17N7O5 — CID 3096826
4-N-(4-methoxyphenyl)-6-methyl-5-nitro-2-N-[(3-nitrophenyl)methylideneamino]pyrimidine-2,4-diamine (PubChem CID 3096826) has the molecular formula C19H17N7O5 and a molecular weight of 423.39 g/mol. Its IUPAC name is 4-N-(4-methoxyphenyl)-6-methyl-5-nitro-2-N-[(3-nitrophenyl)methylideneamino]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(4-methoxyphenyl)-6-methyl-5-nitro-2-N-[(3-nitrophenyl)methylideneamino]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 3096826 |
| Molecular Formula | C19H17N7O5 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 4-N-(4-methoxyphenyl)-6-methyl-5-nitro-2-N-[(3-nitrophenyl)methylideneamino]pyrimidine-2,4-diamine |
| SMILES | COc1ccc(Nc2nc(NN=Cc3cccc([N+](=O)[O-])c3)nc(C)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H17N7O5/c1-12-17(26(29)30)18(22-14-6-8-16(31-2)9-7-14)23-19(21-12)24-20-11-13-4-3-5-15(10-13)25(27)28/h3-11H,1-2H3,(H2,21,22,23,24) |
| InChIKey | BOQJQHNZFQPUBT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 157.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|