C18H17N5O4 — CID 4312871
4-[[4-(4-methoxyanilino)-6-methyl-5-nitropyrimidin-2-yl]amino]phenol (PubChem CID 4312871) has the molecular formula C18H17N5O4 and a molecular weight of 367.37 g/mol. Its IUPAC name is 4-[[4-(4-methoxyanilino)-6-methyl-5-nitropyrimidin-2-yl]amino]phenol.
| Compound Name | 4-[[4-(4-methoxyanilino)-6-methyl-5-nitropyrimidin-2-yl]amino]phenol |
|---|---|
| PubChem CID | 4312871 |
| Molecular Formula | C18H17N5O4 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 4-[[4-(4-methoxyanilino)-6-methyl-5-nitropyrimidin-2-yl]amino]phenol |
| SMILES | COc1ccc(Nc2nc(Nc3ccc(O)cc3)nc(C)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H17N5O4/c1-11-16(23(25)26)17(20-12-5-9-15(27-2)10-6-12)22-18(19-11)21-13-3-7-14(24)8-4-13/h3-10,24H,1-2H3,(H2,19,20,21,22) |
| InChIKey | GGXVNNMIRNKRRX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 122.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|