C19H17N7O4 — CID 2859302
4-[[2-(4-carbamoylanilino)-6-methyl-5-nitropyrimidin-4-yl]amino]benzamide (PubChem CID 2859302) has the molecular formula C19H17N7O4 and a molecular weight of 407.39 g/mol. Its IUPAC name is 4-[[2-(4-carbamoylanilino)-6-methyl-5-nitropyrimidin-4-yl]amino]benzamide.
| Compound Name | 4-[[2-(4-carbamoylanilino)-6-methyl-5-nitropyrimidin-4-yl]amino]benzamide |
|---|---|
| PubChem CID | 2859302 |
| Molecular Formula | C19H17N7O4 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 4-[[2-(4-carbamoylanilino)-6-methyl-5-nitropyrimidin-4-yl]amino]benzamide |
| SMILES | Cc1nc(Nc2ccc(C(N)=O)cc2)nc(Nc2ccc(C(N)=O)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H17N7O4/c1-10-15(26(29)30)18(23-13-6-2-11(3-7-13)16(20)27)25-19(22-10)24-14-8-4-12(5-9-14)17(21)28/h2-9H,1H3,(H2,20,27)(H2,21,28)(H2,22,23,24,25) |
| InChIKey | ZLQJPGIYKYBPDG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 179.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|