C19H19N5O2 — CID 3119600
6-methyl-2-N,4-N-bis(2-methylphenyl)-5-nitropyrimidine-2,4-diamine (PubChem CID 3119600) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is 6-methyl-2-N,4-N-bis(2-methylphenyl)-5-nitropyrimidine-2,4-diamine.
| Compound Name | 6-methyl-2-N,4-N-bis(2-methylphenyl)-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 3119600 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 6-methyl-2-N,4-N-bis(2-methylphenyl)-5-nitropyrimidine-2,4-diamine |
| SMILES | Cc1ccccc1Nc1nc(C)c([N+](=O)[O-])c(Nc2ccccc2C)n1 |
| InChI | InChI=1S/C19H19N5O2/c1-12-8-4-6-10-15(12)21-18-17(24(25)26)14(3)20-19(23-18)22-16-11-7-5-9-13(16)2/h4-11H,1-3H3,(H2,20,21,22,23) |
| InChIKey | VSBUARGUZLRIHS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|