C20H19BrN6O4 — CID 2857645
2-N-[(5-bromo-2-methoxyphenyl)methylideneamino]-4-N-(4-methoxyphenyl)-6-methyl-5-nitropyrimidine-2,4-diamine (PubChem CID 2857645) has the molecular formula C20H19BrN6O4 and a molecular weight of 487.31 g/mol. Its IUPAC name is 2-N-[(5-bromo-2-methoxyphenyl)methylideneamino]-4-N-(4-methoxyphenyl)-6-methyl-5-nitropyrimidine-2,4-diamine.
| Compound Name | 2-N-[(5-bromo-2-methoxyphenyl)methylideneamino]-4-N-(4-methoxyphenyl)-6-methyl-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 2857645 |
| Molecular Formula | C20H19BrN6O4 |
| Molecular Weight | 487.31 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | 2-N-[(5-bromo-2-methoxyphenyl)methylideneamino]-4-N-(4-methoxyphenyl)-6-methyl-5-nitropyrimidine-2,4-diamine |
| SMILES | COc1ccc(Nc2nc(NN=Cc3cc(Br)ccc3OC)nc(C)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H19BrN6O4/c1-12-18(27(28)29)19(24-15-5-7-16(30-2)8-6-15)25-20(23-12)26-22-11-13-10-14(21)4-9-17(13)31-3/h4-11H,1-3H3,(H2,23,24,25,26) |
| InChIKey | UYRWHPXWUGKJNV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 123.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.31 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|