C19H17BrN6O3 — CID 3095794
4-bromo-2-[[[4-methyl-6-(N-methylanilino)-5-nitropyrimidin-2-yl]hydrazinylidene]methyl]phenol (PubChem CID 3095794) has the molecular formula C19H17BrN6O3 and a molecular weight of 457.29 g/mol. Its IUPAC name is 4-bromo-2-[[[4-methyl-6-(N-methylanilino)-5-nitropyrimidin-2-yl]hydrazinylidene]methyl]phenol.
| Compound Name | 4-bromo-2-[[[4-methyl-6-(N-methylanilino)-5-nitropyrimidin-2-yl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 3095794 |
| Molecular Formula | C19H17BrN6O3 |
| Molecular Weight | 457.29 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | 4-bromo-2-[[[4-methyl-6-(N-methylanilino)-5-nitropyrimidin-2-yl]hydrazinylidene]methyl]phenol |
| SMILES | Cc1nc(NN=Cc2cc(Br)ccc2O)nc(N(C)c2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H17BrN6O3/c1-12-17(26(28)29)18(25(2)15-6-4-3-5-7-15)23-19(22-12)24-21-11-13-10-14(20)8-9-16(13)27/h3-11,27H,1-2H3,(H,22,23,24) |
| InChIKey | MSWRMUJJRBOVAF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 116.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.29 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|