C21H18N5O4- — CID 7452741
(E)-3-[3-[[4-methyl-6-(N-methylanilino)-5-nitropyrimidin-2-yl]amino]phenyl]prop-2-enoate (PubChem CID 7452741) has the molecular formula C21H18N5O4- and a molecular weight of 404.41 g/mol. Its IUPAC name is (E)-3-[3-[[4-methyl-6-(N-methylanilino)-5-nitropyrimidin-2-yl]amino]phenyl]prop-2-enoate.
| Compound Name | (E)-3-[3-[[4-methyl-6-(N-methylanilino)-5-nitropyrimidin-2-yl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 7452741 |
| Molecular Formula | C21H18N5O4- |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | (E)-3-[3-[[4-methyl-6-(N-methylanilino)-5-nitropyrimidin-2-yl]amino]phenyl]prop-2-enoate |
| SMILES | Cc1nc(Nc2cccc(/C=C/C(=O)[O-])c2)nc(N(C)c2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C21H19N5O4/c1-14-19(26(29)30)20(25(2)17-9-4-3-5-10-17)24-21(22-14)23-16-8-6-7-15(13-16)11-12-18(27)28/h3-13H,1-2H3,(H,27,28)(H,22,23,24)/p-1/b12-11+ |
| InChIKey | LBWZHRWFOVRSTP-VAWYXSNFSA-M |
| XLogP | 2.97 |
| TPSA | 124.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|