C17H19N7O2 — CID 23938396
2-N-(3,5-dimethyl-1H-pyrazol-4-yl)-4-N,6-dimethyl-5-nitro-4-N-phenylpyrimidine-2,4-diamine (PubChem CID 23938396) has the molecular formula C17H19N7O2 and a molecular weight of 353.39 g/mol. Its IUPAC name is 2-N-(3,5-dimethyl-1H-pyrazol-4-yl)-4-N,6-dimethyl-5-nitro-4-N-phenylpyrimidine-2,4-diamine.
| Compound Name | 2-N-(3,5-dimethyl-1H-pyrazol-4-yl)-4-N,6-dimethyl-5-nitro-4-N-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 23938396 |
| Molecular Formula | C17H19N7O2 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 2-N-(3,5-dimethyl-1H-pyrazol-4-yl)-4-N,6-dimethyl-5-nitro-4-N-phenylpyrimidine-2,4-diamine |
| SMILES | Cc1n[nH]c(C)c1Nc1nc(C)c([N+](=O)[O-])c(N(C)c2ccccc2)n1 |
| InChI | InChI=1S/C17H19N7O2/c1-10-14(11(2)22-21-10)19-17-18-12(3)15(24(25)26)16(20-17)23(4)13-8-6-5-7-9-13/h5-9H,1-4H3,(H,21,22)(H,18,19,20) |
| InChIKey | AMBNKTWQIPCBJM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 112.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|