C11H12N4O4S — CID 43547583
N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-nitrobenzenesulfonamide (PubChem CID 43547583) has the molecular formula C11H12N4O4S and a molecular weight of 296.31 g/mol. Its IUPAC name is N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-nitrobenzenesulfonamide.
| Compound Name | N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 43547583 |
| Molecular Formula | C11H12N4O4S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-nitrobenzenesulfonamide |
| SMILES | Cc1n[nH]c(C)c1NS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12N4O4S/c1-7-11(8(2)13-12-7)14-20(18,19)10-6-4-3-5-9(10)15(16)17/h3-6,14H,1-2H3,(H,12,13) |
| InChIKey | VDDHUKVHPQICPF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|