C11H13N3O3S — CID 81241328
N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-hydroxybenzenesulfonamide (PubChem CID 81241328) has the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. Its IUPAC name is N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-hydroxybenzenesulfonamide.
| Compound Name | N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 81241328 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-hydroxybenzenesulfonamide |
| SMILES | Cc1n[nH]c(C)c1NS(=O)(=O)c1ccccc1O |
| InChI | InChI=1S/C11H13N3O3S/c1-7-11(8(2)13-12-7)14-18(16,17)10-6-4-3-5-9(10)15/h3-6,14-15H,1-2H3,(H,12,13) |
| InChIKey | JHSGETUEOTZYMA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |